C9H11NO3S — CID 166866150
3-methoxysulfanyl-2-methyl-4-nitrocyclohepta-1,3,5-triene (PubChem CID 166866150) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-methoxysulfanyl-2-methyl-4-nitrocyclohepta-1,3,5-triene.
| Compound Name | 3-methoxysulfanyl-2-methyl-4-nitrocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 166866150 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 3-methoxysulfanyl-2-methyl-4-nitrocyclohepta-1,3,5-triene |
| SMILES | COSC1=C([N+](=O)[O-])C=CCC=C1C |
| InChI | InChI=1S/C9H11NO3S/c1-7-5-3-4-6-8(10(11)12)9(7)14-13-2/h4-6H,3H2,1-2H3 |
| InChIKey | JLCLPWCVZBXTBK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|