C8H11NO4 — CID 154632497
2,5-dimethoxy-5-nitrocyclohexa-1,3-diene (PubChem CID 154632497) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2,5-dimethoxy-5-nitrocyclohexa-1,3-diene.
| Compound Name | 2,5-dimethoxy-5-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154632497 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2,5-dimethoxy-5-nitrocyclohexa-1,3-diene |
| SMILES | COC1=CCC(OC)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C8H11NO4/c1-12-7-3-5-8(13-2,6-4-7)9(10)11/h3-5H,6H2,1-2H3 |
| InChIKey | GQBFIAKCZYAEOA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|