About (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate
(1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate (PubChem CID 69127872) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate.
Molecular Properties
| Compound Name | (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate |
| PubChem CID | 69127872 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate |
| SMILES | COC1=CCC(OC)(OC(=O)CCCCO)C=C1 |
| InChI | InChI=1S/C13H20O5/c1-16-11-6-8-13(17-2,9-7-11)18-12(15)5-3-4-10-14/h6-8,14H,3-5,9-10H2,1-2H3 |
| InChIKey | RLSHGYLHAPHLDI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate?
The IUPAC name of (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate (CID 69127872) is (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate.
What is the SMILES notation for (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate?
The canonical SMILES for (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate is COC1=CCC(OC)(OC(=O)CCCCO)C=C1.
What is the InChIKey of (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate?
The InChIKey is RLSHGYLHAPHLDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5/c1-16-11-6-8-13(17-2,9-7-11)18-12(15)5-3-4-10-14/h6-8,14H,3-5,9-10H2,1-2H3.
What are the key properties of (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate?
(1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate has a molecular weight of 256.30 g/mol, XLogP of 1.53, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate is sourced from PubChem (CID 69127872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).