C13H20O5 — CID 69127872
(1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate (PubChem CID 69127872) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate.
| Compound Name | (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate |
|---|---|
| PubChem CID | 69127872 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1,4-dimethoxycyclohexa-2,4-dien-1-yl) 5-hydroxypentanoate |
| SMILES | COC1=CCC(OC)(OC(=O)CCCCO)C=C1 |
| InChI | InChI=1S/C13H20O5/c1-16-11-6-8-13(17-2,9-7-11)18-12(15)5-3-4-10-14/h6-8,14H,3-5,9-10H2,1-2H3 |
| InChIKey | RLSHGYLHAPHLDI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|