C13H12FeO6 — CID 10881734
carbon monoxide;iron;8-methoxy-1-oxaspiro[4.5]deca-6,8-dien-2-one (PubChem CID 10881734) has the molecular formula C13H12FeO6 and a molecular weight of 320.08 g/mol. Its IUPAC name is carbon monoxide;iron;8-methoxy-1-oxaspiro[4.5]deca-6,8-dien-2-one.
| Compound Name | carbon monoxide;iron;8-methoxy-1-oxaspiro[4.5]deca-6,8-dien-2-one |
|---|---|
| PubChem CID | 10881734 |
| Molecular Formula | C13H12FeO6 |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | carbon monoxide;iron;8-methoxy-1-oxaspiro[4.5]deca-6,8-dien-2-one |
| SMILES | COC1=CCC2(C=C1)CCC(=O)O2.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C10H12O3.3CO.Fe/c1-12-8-2-5-10(6-3-8)7-4-9(11)13-10;3*1-2;/h2-3,5H,4,6-7H2,1H3;;;; |
| InChIKey | GVLHCCDOIYSJGD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|