About 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene
2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene (PubChem CID 175902304) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene |
| PubChem CID | 175902304 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene |
| SMILES | CC=CC1(C=CC)C=CC(OC)=CC1 |
| InChI | InChI=1S/C13H18O/c1-4-8-13(9-5-2)10-6-12(14-3)7-11-13/h4-10H,11H2,1-3H3 |
| InChIKey | IAJWEMIRFNTAPT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene?
The IUPAC name of 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene (CID 175902304) is 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene.
What is the SMILES notation for 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene?
The canonical SMILES for 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene is CC=CC1(C=CC)C=CC(OC)=CC1.
What is the InChIKey of 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene?
The InChIKey is IAJWEMIRFNTAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-4-8-13(9-5-2)10-6-12(14-3)7-11-13/h4-10H,11H2,1-3H3.
What are the key properties of 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene?
2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene has a molecular weight of 190.29 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5,5-bis(prop-1-enyl)cyclohexa-1,3-diene is sourced from PubChem (CID 175902304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).