C13H13F3O3 — CID 122380842
(5R)-5-(4-methoxyphenyl)-5-(2,2,2-trifluoroethyl)oxolan-2-one (PubChem CID 122380842) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is (5R)-5-(4-methoxyphenyl)-5-(2,2,2-trifluoroethyl)oxolan-2-one.
| Compound Name | (5R)-5-(4-methoxyphenyl)-5-(2,2,2-trifluoroethyl)oxolan-2-one |
|---|---|
| PubChem CID | 122380842 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (5R)-5-(4-methoxyphenyl)-5-(2,2,2-trifluoroethyl)oxolan-2-one |
| SMILES | COc1ccc([C@]2(CC(F)(F)F)CCC(=O)O2)cc1 |
| InChI | InChI=1S/C13H13F3O3/c1-18-10-4-2-9(3-5-10)12(8-13(14,15)16)7-6-11(17)19-12/h2-5H,6-8H2,1H3/t12-/m1/s1 |
| InChIKey | HJNMDNIMWCDXKV-GFCCVEGCSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |