C18H15F3O3 — CID 102284704
(4S,5S)-4-(4-methoxyphenyl)-5-phenyl-5-(trifluoromethyl)oxolan-2-one (PubChem CID 102284704) has the molecular formula C18H15F3O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is (4S,5S)-4-(4-methoxyphenyl)-5-phenyl-5-(trifluoromethyl)oxolan-2-one.
| Compound Name | (4S,5S)-4-(4-methoxyphenyl)-5-phenyl-5-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 102284704 |
| Molecular Formula | C18H15F3O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (4S,5S)-4-(4-methoxyphenyl)-5-phenyl-5-(trifluoromethyl)oxolan-2-one |
| SMILES | COc1ccc([C@@H]2CC(=O)O[C@@]2(c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3O3/c1-23-14-9-7-12(8-10-14)15-11-16(22)24-17(15,18(19,20)21)13-5-3-2-4-6-13/h2-10,15H,11H2,1H3/t15-,17+/m0/s1 |
| InChIKey | PYZUGPCAQDOXDX-DOTOQJQBSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |