C19H20O4 — CID 102142146
(4S)-5,5-bis(4-methoxyphenyl)-4-methyloxolan-2-one (PubChem CID 102142146) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (4S)-5,5-bis(4-methoxyphenyl)-4-methyloxolan-2-one.
| Compound Name | (4S)-5,5-bis(4-methoxyphenyl)-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 102142146 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (4S)-5,5-bis(4-methoxyphenyl)-4-methyloxolan-2-one |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)OC(=O)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C19H20O4/c1-13-12-18(20)23-19(13,14-4-8-16(21-2)9-5-14)15-6-10-17(22-3)11-7-15/h4-11,13H,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | YBHSAKZOAUNZMG-ZDUSSCGKSA-N |
| XLogP | 3.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |