C11H10N2O3S2 — CID 90205453
6-(4-methoxyphenyl)-7,8-dithia-1,4-diazabicyclo[4.2.0]octane-3,5-dione (PubChem CID 90205453) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-7,8-dithia-1,4-diazabicyclo[4.2.0]octane-3,5-dione.
| Compound Name | 6-(4-methoxyphenyl)-7,8-dithia-1,4-diazabicyclo[4.2.0]octane-3,5-dione |
|---|---|
| PubChem CID | 90205453 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 6-(4-methoxyphenyl)-7,8-dithia-1,4-diazabicyclo[4.2.0]octane-3,5-dione |
| SMILES | COc1ccc(C23SSN2CC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C11H10N2O3S2/c1-16-8-4-2-7(3-5-8)11-10(15)12-9(14)6-13(11)18-17-11/h2-5H,6H2,1H3,(H,12,14,15) |
| InChIKey | NFLIPAJVPBPJLP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|