C15H18N2O4 — CID 14661010
10-(4-methoxyphenyl)-10-methyl-9-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 14661010) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 10-(4-methoxyphenyl)-10-methyl-9-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 10-(4-methoxyphenyl)-10-methyl-9-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 14661010 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 10-(4-methoxyphenyl)-10-methyl-9-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(C2(C)OCCCC23NC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-14(10-4-6-11(20-2)7-5-10)15(8-3-9-21-14)12(18)16-13(19)17-15/h4-7H,3,8-9H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | VGCUINQBQZOEHV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|