C16H18N2O5 — CID 66831836
(4aS,10S,10aR)-8-methoxy-10a-methylspiro[2,3,4,4a-tetrahydropyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione (PubChem CID 66831836) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is (4aS,10S,10aR)-8-methoxy-10a-methylspiro[2,3,4,4a-tetrahydropyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4aS,10S,10aR)-8-methoxy-10a-methylspiro[2,3,4,4a-tetrahydropyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 66831836 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (4aS,10S,10aR)-8-methoxy-10a-methylspiro[2,3,4,4a-tetrahydropyrano[3,2-b]chromene-10,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)[C@]1(NC(=O)NC1=O)[C@@]1(C)OCCC[C@@H]1O2 |
| InChI | InChI=1S/C16H18N2O5/c1-15-12(4-3-7-22-15)23-11-6-5-9(21-2)8-10(11)16(15)13(19)17-14(20)18-16/h5-6,8,12H,3-4,7H2,1-2H3,(H2,17,18,19,20)/t12-,15-,16+/m0/s1 |
| InChIKey | GOTDQWMAAPIOKV-VBNZEHGJSA-N |
| XLogP | 1.06 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|