C11H16N2O3 — CID 86103756
3-(4-methoxyphenyl)-5-methylpyrazolidine-3,5-diol (PubChem CID 86103756) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-methylpyrazolidine-3,5-diol.
| Compound Name | 3-(4-methoxyphenyl)-5-methylpyrazolidine-3,5-diol |
|---|---|
| PubChem CID | 86103756 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-methylpyrazolidine-3,5-diol |
| SMILES | COc1ccc(C2(O)CC(C)(O)NN2)cc1 |
| InChI | InChI=1S/C11H16N2O3/c1-10(14)7-11(15,13-12-10)8-3-5-9(16-2)6-4-8/h3-6,12-15H,7H2,1-2H3 |
| InChIKey | OWBXRSJLBGVZFI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |