C16H24O2 — CID 80698548
1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylcyclopentan-1-ol (PubChem CID 80698548) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylcyclopentan-1-ol.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 80698548 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3,3-dimethylcyclopentan-1-ol |
| SMILES | COc1ccc(CCC2(O)CCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H24O2/c1-15(2)10-11-16(17,12-15)9-8-13-4-6-14(18-3)7-5-13/h4-7,17H,8-12H2,1-3H3 |
| InChIKey | KYHLYLKMBVGVCR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |