C13H17ClO — CID 101110346
1-[2-[(1R,2R)-2-chloro-1-methylcyclopropyl]ethyl]-4-methoxybenzene (PubChem CID 101110346) has the molecular formula C13H17ClO and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-2-chloro-1-methylcyclopropyl]ethyl]-4-methoxybenzene.
| Compound Name | 1-[2-[(1R,2R)-2-chloro-1-methylcyclopropyl]ethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101110346 |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-[2-[(1R,2R)-2-chloro-1-methylcyclopropyl]ethyl]-4-methoxybenzene |
| SMILES | COc1ccc(CC[C@]2(C)C[C@H]2Cl)cc1 |
| InChI | InChI=1S/C13H17ClO/c1-13(9-12(13)14)8-7-10-3-5-11(15-2)6-4-10/h3-6,12H,7-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | RHMQUOJDSPJIOQ-CHWSQXEVSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|