C14H17NO3 — CID 140944867
(3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 140944867) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 140944867 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | COc1ccc([C@@H](C)[C@]2(C)CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H17NO3/c1-9(10-4-6-11(18-3)7-5-10)14(2)8-12(16)15-13(14)17/h4-7,9H,8H2,1-3H3,(H,15,16,17)/t9-,14+/m1/s1 |
| InChIKey | ROWSROHFESZWEO-OTYXRUKQSA-N |
| XLogP | 1.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|