C33H31NO3 — CID 140944865
(3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione (PubChem CID 140944865) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 140944865 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (3S)-3-[(1R)-1-(4-methoxyphenyl)ethyl]-3-methyl-1-tritylpyrrolidine-2,5-dione |
| SMILES | COc1ccc([C@@H](C)[C@]2(C)CC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C33H31NO3/c1-24(25-19-21-29(37-3)22-20-25)32(2)23-30(35)34(31(32)36)33(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-22,24H,23H2,1-3H3/t24-,32+/m1/s1 |
| InChIKey | ICUVIIQIHBDGJG-QNLPTKCRSA-N |
| XLogP | 6.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|