C23H27NO4 — CID 146624379
(3S)-3-[1-[4-(2-hydroxyethyl)phenyl]ethyl]-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 146624379) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3S)-3-[1-[4-(2-hydroxyethyl)phenyl]ethyl]-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[1-[4-(2-hydroxyethyl)phenyl]ethyl]-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146624379 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (3S)-3-[1-[4-(2-hydroxyethyl)phenyl]ethyl]-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)C[C@@](C)(C(C)c3ccc(CCO)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-16(19-8-4-17(5-9-19)12-13-25)23(2)14-21(26)24(22(23)27)15-18-6-10-20(28-3)11-7-18/h4-11,16,25H,12-15H2,1-3H3/t16?,23-/m0/s1 |
| InChIKey | RFVIFEUZEHSBBX-KESSSICBSA-N |
| XLogP | 3.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|