C11H12N2O4 — CID 4770213
1-(2,5-dimethoxyphenyl)imidazolidine-2,4-dione (PubChem CID 4770213) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4770213 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(OC)c(N2CC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H12N2O4/c1-16-7-3-4-9(17-2)8(5-7)13-6-10(14)12-11(13)15/h3-5H,6H2,1-2H3,(H,12,14,15) |
| InChIKey | ROPXTRDBWDFCMA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|