C15H21NO3 — CID 117020960
1-(2,5-dimethoxyphenyl)-6,6-dimethylpiperidin-3-one (PubChem CID 117020960) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-6,6-dimethylpiperidin-3-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-6,6-dimethylpiperidin-3-one |
|---|---|
| PubChem CID | 117020960 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-6,6-dimethylpiperidin-3-one |
| SMILES | COc1ccc(OC)c(N2CC(=O)CCC2(C)C)c1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2)8-7-11(17)10-16(15)13-9-12(18-3)5-6-14(13)19-4/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | QGHQYFPEGDULHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |