C14H19NO — CID 117020918
6,6-dimethyl-1-(2-methylphenyl)piperidin-3-one (PubChem CID 117020918) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 6,6-dimethyl-1-(2-methylphenyl)piperidin-3-one.
| Compound Name | 6,6-dimethyl-1-(2-methylphenyl)piperidin-3-one |
|---|---|
| PubChem CID | 117020918 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 6,6-dimethyl-1-(2-methylphenyl)piperidin-3-one |
| SMILES | Cc1ccccc1N1CC(=O)CCC1(C)C |
| InChI | InChI=1S/C14H19NO/c1-11-6-4-5-7-13(11)15-10-12(16)8-9-14(15,2)3/h4-7H,8-10H2,1-3H3 |
| InChIKey | ARDKXDBTEOMDDL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |