C25H44N2O4 — CID 150019369
(1,6-diamino-4-methyl-6-nonanoyloxycyclohexa-2,4-dien-1-yl) nonanoate (PubChem CID 150019369) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is (1,6-diamino-4-methyl-6-nonanoyloxycyclohexa-2,4-dien-1-yl) nonanoate.
| Compound Name | (1,6-diamino-4-methyl-6-nonanoyloxycyclohexa-2,4-dien-1-yl) nonanoate |
|---|---|
| PubChem CID | 150019369 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (1,6-diamino-4-methyl-6-nonanoyloxycyclohexa-2,4-dien-1-yl) nonanoate |
| SMILES | CCCCCCCCC(=O)OC1(N)C=CC(C)=CC1(N)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C25H44N2O4/c1-4-6-8-10-12-14-16-22(28)30-24(26)19-18-21(3)20-25(24,27)31-23(29)17-15-13-11-9-7-5-2/h18-20H,4-17,26-27H2,1-3H3 |
| InChIKey | DEYHFHDIERSJSV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|