C8H9BrO4 — CID 150621406
4-bromooxy-4-methoxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 150621406) has the molecular formula C8H9BrO4 and a molecular weight of 249.06 g/mol. Its IUPAC name is 4-bromooxy-4-methoxycyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-bromooxy-4-methoxycyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 150621406 |
| Molecular Formula | C8H9BrO4 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 4-bromooxy-4-methoxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | COC1(OBr)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C8H9BrO4/c1-12-8(13-9)4-2-6(3-5-8)7(10)11/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | IVZIZLAZPNSLET-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|