C12H18O4 — CID 175180535
methyl 3-(4,4-dimethoxycyclohexa-1,5-dien-1-yl)propanoate (PubChem CID 175180535) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is methyl 3-(4,4-dimethoxycyclohexa-1,5-dien-1-yl)propanoate.
| Compound Name | methyl 3-(4,4-dimethoxycyclohexa-1,5-dien-1-yl)propanoate |
|---|---|
| PubChem CID | 175180535 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | methyl 3-(4,4-dimethoxycyclohexa-1,5-dien-1-yl)propanoate |
| SMILES | COC(=O)CCC1=CCC(OC)(OC)C=C1 |
| InChI | InChI=1S/C12H18O4/c1-14-11(13)5-4-10-6-8-12(15-2,16-3)9-7-10/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | JAVCPSGVKCEVJK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|