C10H10Cl2O3 — CID 151701976
methyl 3-(4,4-dichlorocyclohexa-1,5-dien-1-yl)-3-oxopropanoate (PubChem CID 151701976) has the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. Its IUPAC name is methyl 3-(4,4-dichlorocyclohexa-1,5-dien-1-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(4,4-dichlorocyclohexa-1,5-dien-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 151701976 |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | methyl 3-(4,4-dichlorocyclohexa-1,5-dien-1-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)C1=CCC(Cl)(Cl)C=C1 |
| InChI | InChI=1S/C10H10Cl2O3/c1-15-9(14)6-8(13)7-2-4-10(11,12)5-3-7/h2-4H,5-6H2,1H3 |
| InChIKey | REUKOPHGNQSXKE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|