C10H11ClO6S — CID 150826906
2-(1-chloro-4-methoxycarbonylcyclohexa-2,4-dien-1-yl)sulfonylacetic acid (PubChem CID 150826906) has the molecular formula C10H11ClO6S and a molecular weight of 294.71 g/mol. Its IUPAC name is 2-(1-chloro-4-methoxycarbonylcyclohexa-2,4-dien-1-yl)sulfonylacetic acid.
| Compound Name | 2-(1-chloro-4-methoxycarbonylcyclohexa-2,4-dien-1-yl)sulfonylacetic acid |
|---|---|
| PubChem CID | 150826906 |
| Molecular Formula | C10H11ClO6S |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-(1-chloro-4-methoxycarbonylcyclohexa-2,4-dien-1-yl)sulfonylacetic acid |
| SMILES | COC(=O)C1=CCC(Cl)(S(=O)(=O)CC(=O)O)C=C1 |
| InChI | InChI=1S/C10H11ClO6S/c1-17-9(14)7-2-4-10(11,5-3-7)18(15,16)6-8(12)13/h2-4H,5-6H2,1H3,(H,12,13) |
| InChIKey | KLCPHOVJGFLQFS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|