C9H11ClO5 — CID 172691204
methyl 5-chloro-4-hydroperoxy-4-methoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 172691204) has the molecular formula C9H11ClO5 and a molecular weight of 234.63 g/mol. Its IUPAC name is methyl 5-chloro-4-hydroperoxy-4-methoxycyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 5-chloro-4-hydroperoxy-4-methoxycyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 172691204 |
| Molecular Formula | C9H11ClO5 |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | methyl 5-chloro-4-hydroperoxy-4-methoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(OC)(OO)C(Cl)=C1 |
| InChI | InChI=1S/C9H11ClO5/c1-13-8(11)6-3-4-9(14-2,15-12)7(10)5-6/h3,5,12H,4H2,1-2H3 |
| InChIKey | BRWZIAVXXDTXKV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|