C8H12ClN3O3 — CID 172738881
[6-amino-3-(hydrazinecarbonyl)-6-methoxycyclohexa-1,3-dien-1-yl] hypochlorite (PubChem CID 172738881) has the molecular formula C8H12ClN3O3 and a molecular weight of 233.65 g/mol. Its IUPAC name is [6-amino-3-(hydrazinecarbonyl)-6-methoxycyclohexa-1,3-dien-1-yl] hypochlorite.
| Compound Name | [6-amino-3-(hydrazinecarbonyl)-6-methoxycyclohexa-1,3-dien-1-yl] hypochlorite |
|---|---|
| PubChem CID | 172738881 |
| Molecular Formula | C8H12ClN3O3 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | [6-amino-3-(hydrazinecarbonyl)-6-methoxycyclohexa-1,3-dien-1-yl] hypochlorite |
| SMILES | COC1(N)CC=C(C(=O)NN)C=C1OCl |
| InChI | InChI=1S/C8H12ClN3O3/c1-14-8(10)3-2-5(7(13)12-11)4-6(8)15-9/h2,4H,3,10-11H2,1H3,(H,12,13) |
| InChIKey | IUXJDDWFNCMLDF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|