C7H8N2O2 — CID 22993290
4-oxocyclohexa-1,5-diene-1-carbohydrazide (PubChem CID 22993290) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-oxocyclohexa-1,5-diene-1-carbohydrazide.
| Compound Name | 4-oxocyclohexa-1,5-diene-1-carbohydrazide |
|---|---|
| PubChem CID | 22993290 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 4-oxocyclohexa-1,5-diene-1-carbohydrazide |
| SMILES | NNC(=O)C1=CCC(=O)C=C1 |
| InChI | InChI=1S/C7H8N2O2/c8-9-7(11)5-1-3-6(10)4-2-5/h1-3H,4,8H2,(H,9,11) |
| InChIKey | UKKRNQOZAXRHGJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|