C12H17NO2 — CID 141478377
4-formyl-4-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 141478377) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-formyl-4-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 4-formyl-4-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 141478377 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-formyl-4-methyl-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC(C)NC(=O)C1=CCC(C)(C=O)C=C1 |
| InChI | InChI=1S/C12H17NO2/c1-9(2)13-11(15)10-4-6-12(3,8-14)7-5-10/h4-6,8-9H,7H2,1-3H3,(H,13,15) |
| InChIKey | COIDBKPTJVAAEO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|