About N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide
N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 70944232) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 70944232 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC1(C)C=CC(C(=O)NC2CCCCC2)=CC1 |
| InChI | InChI=1S/C15H23NO/c1-15(2)10-8-12(9-11-15)14(17)16-13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,16,17) |
| InChIKey | BRYYDIBRGPULDI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide (CID 70944232) is N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide is CC1(C)C=CC(C(=O)NC2CCCCC2)=CC1.
What is the InChIKey of N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide?
The InChIKey is BRYYDIBRGPULDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-15(2)10-8-12(9-11-15)14(17)16-13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,16,17).
What are the key properties of N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide?
N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide has a molecular weight of 233.35 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4,4-dimethylcyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 70944232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).