C27H42N2O2 — CID 144544353
(1E,4E,6Z,9Z)-1-N,5-N-dicyclohexyl-8-methylcyclodeca-1,4,6,9-tetraene-1,5-dicarboxamide;ethane (PubChem CID 144544353) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (1E,4E,6Z,9Z)-1-N,5-N-dicyclohexyl-8-methylcyclodeca-1,4,6,9-tetraene-1,5-dicarboxamide;ethane.
| Compound Name | (1E,4E,6Z,9Z)-1-N,5-N-dicyclohexyl-8-methylcyclodeca-1,4,6,9-tetraene-1,5-dicarboxamide;ethane |
|---|---|
| PubChem CID | 144544353 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (1E,4E,6Z,9Z)-1-N,5-N-dicyclohexyl-8-methylcyclodeca-1,4,6,9-tetraene-1,5-dicarboxamide;ethane |
| SMILES | CC.CC1/C=C\C(C(=O)NC2CCCCC2)=C/C/C=C(C(=O)NC2CCCCC2)\C=C/1 |
| InChI | InChI=1S/C25H36N2O2.C2H6/c1-19-15-17-20(24(28)26-22-11-4-2-5-12-22)9-8-10-21(18-16-19)25(29)27-23-13-6-3-7-14-23;1-2/h9-10,15-19,22-23H,2-8,11-14H2,1H3,(H,26,28)(H,27,29);1-2H3/b17-15-,18-16-,20-9+,21-10+; |
| InChIKey | KJZDPCQIZBSRPI-DPLPZWCISA-N |
| XLogP | 5.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |