C15H15ClO3 — CID 154137421
1-(4-chloro-4-methoxycyclohexa-1,5-dien-1-yl)-2-hydroxy-2-phenylethanone (PubChem CID 154137421) has the molecular formula C15H15ClO3 and a molecular weight of 278.74 g/mol. Its IUPAC name is 1-(4-chloro-4-methoxycyclohexa-1,5-dien-1-yl)-2-hydroxy-2-phenylethanone.
| Compound Name | 1-(4-chloro-4-methoxycyclohexa-1,5-dien-1-yl)-2-hydroxy-2-phenylethanone |
|---|---|
| PubChem CID | 154137421 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-(4-chloro-4-methoxycyclohexa-1,5-dien-1-yl)-2-hydroxy-2-phenylethanone |
| SMILES | COC1(Cl)C=CC(C(=O)C(O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C15H15ClO3/c1-19-15(16)9-7-12(8-10-15)14(18)13(17)11-5-3-2-4-6-11/h2-9,13,17H,10H2,1H3 |
| InChIKey | HSZWYVOVXFNOIZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|