C15H17N3O4S — CID 139836724
methyl 4-acetyloxy-4-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-1,5-diene-1-carboxylate (PubChem CID 139836724) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl 4-acetyloxy-4-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-acetyloxy-4-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 139836724 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 4-acetyloxy-4-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(CN2CCS/C2=N\C#N)(OC(C)=O)C=C1 |
| InChI | InChI=1S/C15H17N3O4S/c1-11(19)22-15(5-3-12(4-6-15)13(20)21-2)9-18-7-8-23-14(18)17-10-16/h3-5H,6-9H2,1-2H3/b17-14- |
| InChIKey | UGOGVODDIVBZMY-VKAVYKQESA-N |
| XLogP | 1.23 |
| TPSA | 91.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|