C18H15Cl2N3O2S — CID 139836723
[5,6-dichloro-1-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-2,4-dien-1-yl] benzoate (PubChem CID 139836723) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is [5,6-dichloro-1-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-2,4-dien-1-yl] benzoate.
| Compound Name | [5,6-dichloro-1-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-2,4-dien-1-yl] benzoate |
|---|---|
| PubChem CID | 139836723 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [5,6-dichloro-1-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]cyclohexa-2,4-dien-1-yl] benzoate |
| SMILES | N#C/N=C1\SCCN1CC1(OC(=O)c2ccccc2)C=CC=C(Cl)C1Cl |
| InChI | InChI=1S/C18H15Cl2N3O2S/c19-14-7-4-8-18(15(14)20,11-23-9-10-26-17(23)22-12-21)25-16(24)13-5-2-1-3-6-13/h1-8,15H,9-11H2/b22-17- |
| InChIKey | CNIVRJDCBGTLHU-XLNRJJMWSA-N |
| XLogP | 3.77 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|