C13H11Cl2N3O2S — CID 15545017
methyl 2,4-dichloro-3-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]benzoate (PubChem CID 15545017) has the molecular formula C13H11Cl2N3O2S and a molecular weight of 344.22 g/mol. Its IUPAC name is methyl 2,4-dichloro-3-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]benzoate.
| Compound Name | methyl 2,4-dichloro-3-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]benzoate |
|---|---|
| PubChem CID | 15545017 |
| Molecular Formula | C13H11Cl2N3O2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | methyl 2,4-dichloro-3-[(2-cyanoimino-1,3-thiazolidin-3-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(CN2CCS/C2=N\C#N)c1Cl |
| InChI | InChI=1S/C13H11Cl2N3O2S/c1-20-12(19)8-2-3-10(14)9(11(8)15)6-18-4-5-21-13(18)17-7-16/h2-3H,4-6H2,1H3/b17-13- |
| InChIKey | VXFQEMBLUBHISF-LGMDPLHJSA-N |
| XLogP | 3.17 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|