C19H15Cl2IO6 — CID 175316930
2-[(2,6-dichloro-3-methoxycarbonylphenyl)methyl]-4-(iodomethyl)-5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 175316930) has the molecular formula C19H15Cl2IO6 and a molecular weight of 537.13 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3-methoxycarbonylphenyl)methyl]-4-(iodomethyl)-5-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 2-[(2,6-dichloro-3-methoxycarbonylphenyl)methyl]-4-(iodomethyl)-5-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175316930 |
| Molecular Formula | C19H15Cl2IO6 |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 535.93 |
| IUPAC Name | 2-[(2,6-dichloro-3-methoxycarbonylphenyl)methyl]-4-(iodomethyl)-5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | COC(=O)c1ccc(Cl)c(Cc2c(C(=O)O)cc(C)c(CI)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C19H15Cl2IO6/c1-8-5-11(17(23)24)10(15(18(25)26)13(8)7-22)6-12-14(20)4-3-9(16(12)21)19(27)28-2/h3-5H,6-7H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | ONFUZKBAIUCUBZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|