C18H16Cl2N2O2 — CID 145203620
2,4-dichloro-3-[(1,4,6-trimethylbenzimidazol-2-yl)methyl]benzoic acid (PubChem CID 145203620) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 2,4-dichloro-3-[(1,4,6-trimethylbenzimidazol-2-yl)methyl]benzoic acid.
| Compound Name | 2,4-dichloro-3-[(1,4,6-trimethylbenzimidazol-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 145203620 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2,4-dichloro-3-[(1,4,6-trimethylbenzimidazol-2-yl)methyl]benzoic acid |
| SMILES | Cc1cc(C)c2nc(Cc3c(Cl)ccc(C(=O)O)c3Cl)n(C)c2c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-9-6-10(2)17-14(7-9)22(3)15(21-17)8-12-13(19)5-4-11(16(12)20)18(23)24/h4-7H,8H2,1-3H3,(H,23,24) |
| InChIKey | VKUKMTGDDUZYOY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |