C22H21Cl2F3N4O — CID 156678544
2-[2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]piperazine-1-carbaldehyde (PubChem CID 156678544) has the molecular formula C22H21Cl2F3N4O and a molecular weight of 485.34 g/mol. Its IUPAC name is 2-[2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]piperazine-1-carbaldehyde.
| Compound Name | 2-[2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 156678544 |
| Molecular Formula | C22H21Cl2F3N4O |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 2-[2,4-dichloro-3-[[1,4-dimethyl-6-(trifluoromethyl)benzimidazol-2-yl]methyl]phenyl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(C(F)(F)F)cc2c1nc(Cc1c(Cl)ccc(C3CNCCN3C=O)c1Cl)n2C |
| InChI | InChI=1S/C22H21Cl2F3N4O/c1-12-7-13(22(25,26)27)8-17-21(12)29-19(30(17)2)9-15-16(23)4-3-14(20(15)24)18-10-28-5-6-31(18)11-32/h3-4,7-8,11,18,28H,5-6,9-10H2,1-2H3 |
| InChIKey | PHFYFDQCWNSGAL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|