C26H27Cl2F2N3O2 — CID 145206642
2,4-dichloro-3-[[6-(1,1-difluoroprop-2-enyl)-1,4-dimethylbenzimidazol-2-yl]methyl]-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 145206642) has the molecular formula C26H27Cl2F2N3O2 and a molecular weight of 522.42 g/mol. Its IUPAC name is 2,4-dichloro-3-[[6-(1,1-difluoroprop-2-enyl)-1,4-dimethylbenzimidazol-2-yl]methyl]-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 2,4-dichloro-3-[[6-(1,1-difluoroprop-2-enyl)-1,4-dimethylbenzimidazol-2-yl]methyl]-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 145206642 |
| Molecular Formula | C26H27Cl2F2N3O2 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2,4-dichloro-3-[[6-(1,1-difluoroprop-2-enyl)-1,4-dimethylbenzimidazol-2-yl]methyl]-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | C=CC(F)(F)c1cc(C)c2nc(Cc3c(Cl)ccc(C(=O)NC4CCC(O)CC4)c3Cl)n(C)c2c1 |
| InChI | InChI=1S/C26H27Cl2F2N3O2/c1-4-26(29,30)15-11-14(2)24-21(12-15)33(3)22(32-24)13-19-20(27)10-9-18(23(19)28)25(35)31-16-5-7-17(34)8-6-16/h4,9-12,16-17,34H,1,5-8,13H2,2-3H3,(H,31,35) |
| InChIKey | HZMXRXNCWZGJFV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|