C18H14Cl2N2O3 — CID 146494487
2,4-dichloro-3-[(1,4-dimethyl-6-nitrosoindol-2-yl)methyl]benzoic acid (PubChem CID 146494487) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2,4-dichloro-3-[(1,4-dimethyl-6-nitrosoindol-2-yl)methyl]benzoic acid.
| Compound Name | 2,4-dichloro-3-[(1,4-dimethyl-6-nitrosoindol-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 146494487 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2,4-dichloro-3-[(1,4-dimethyl-6-nitrosoindol-2-yl)methyl]benzoic acid |
| SMILES | Cc1cc(N=O)cc2c1cc(Cc1c(Cl)ccc(C(=O)O)c1Cl)n2C |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-9-5-10(21-25)6-16-13(9)7-11(22(16)2)8-14-15(19)4-3-12(17(14)20)18(23)24/h3-7H,8H2,1-2H3,(H,23,24) |
| InChIKey | LXAHZAQYOTZLOJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |