About 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid
4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 154212959) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 154212959 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CCN(CC)CCC1(N)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C13H22N2O2/c1-3-15(4-2)10-9-13(14)7-5-11(6-8-13)12(16)17/h5-7H,3-4,8-10,14H2,1-2H3,(H,16,17) |
| InChIKey | AMYZZJKTULMILK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid (CID 154212959) is 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid is CCN(CC)CCC1(N)C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is AMYZZJKTULMILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-3-15(4-2)10-9-13(14)7-5-11(6-8-13)12(16)17/h5-7H,3-4,8-10,14H2,1-2H3,(H,16,17).
What are the key properties of 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid?
4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 238.33 g/mol, XLogP of 1.39, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-[2-(diethylamino)ethyl]cyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 154212959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).