3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid

C14H23N3O2 — CID 70363525

IUPAC3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid
SMILESCCN(CC)CCCc1c(C(=O)O)ccc(N)c1N
InChIInChI=1S/C14H23N3O2/c1-3-17(4-2)9-5-6-10-11(14(18)19)7-8-12(15)13(10)16/h7-8H,3-6,9,15-16H2,1-2H3,(H,18,19)
InChIKeyRAISPOZXBLVJOB-UHFFFAOYSA-N
MW265.36 g/mol
LogP1.82
Rot. Bonds7

About 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid

3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid (PubChem CID 70363525) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid.

Molecular Properties

Compound Name3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid
PubChem CID70363525
Molecular FormulaC14H23N3O2
Molecular Weight265.36 g/mol
Exact Mass265.18
IUPAC Name3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid
SMILESCCN(CC)CCCc1c(C(=O)O)ccc(N)c1N
InChIInChI=1S/C14H23N3O2/c1-3-17(4-2)9-5-6-10-11(14(18)19)7-8-12(15)13(10)16/h7-8H,3-6,9,15-16H2,1-2H3,(H,18,19)
InChIKeyRAISPOZXBLVJOB-UHFFFAOYSA-N
XLogP1.82
TPSA92.58 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.36
LogP ≤ 51.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid?
The IUPAC name of 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid (CID 70363525) is 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid.
What is the SMILES notation for 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid?
The canonical SMILES for 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid is CCN(CC)CCCc1c(C(=O)O)ccc(N)c1N.
What is the InChIKey of 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid?
The InChIKey is RAISPOZXBLVJOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-3-17(4-2)9-5-6-10-11(14(18)19)7-8-12(15)13(10)16/h7-8H,3-6,9,15-16H2,1-2H3,(H,18,19).
What are the key properties of 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid?
3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid has a molecular weight of 265.36 g/mol, XLogP of 1.82, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-2-[3-(diethylamino)propyl]benzoic acid is sourced from PubChem (CID 70363525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).