C15H25N — CID 3024726
3-(2,6-dimethylphenyl)-N,N-diethylpropan-1-amine (PubChem CID 3024726) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-N,N-diethylpropan-1-amine.
| Compound Name | 3-(2,6-dimethylphenyl)-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 3024726 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCc1c(C)cccc1C |
| InChI | InChI=1S/C15H25N/c1-5-16(6-2)12-8-11-15-13(3)9-7-10-14(15)4/h7,9-10H,5-6,8,11-12H2,1-4H3 |
| InChIKey | PLCHGXPNQCZOTJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |