C17H28N3O2- — CID 19862807
3,4-diamino-2-[2-(dibutylamino)ethyl]benzoate (PubChem CID 19862807) has the molecular formula C17H28N3O2- and a molecular weight of 306.43 g/mol. Its IUPAC name is 3,4-diamino-2-[2-(dibutylamino)ethyl]benzoate.
| Compound Name | 3,4-diamino-2-[2-(dibutylamino)ethyl]benzoate |
|---|---|
| PubChem CID | 19862807 |
| Molecular Formula | C17H28N3O2- |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 3,4-diamino-2-[2-(dibutylamino)ethyl]benzoate |
| SMILES | CCCCN(CCCC)CCc1c(C(=O)[O-])ccc(N)c1N |
| InChI | InChI=1S/C17H29N3O2/c1-3-5-10-20(11-6-4-2)12-9-13-14(17(21)22)7-8-15(18)16(13)19/h7-8H,3-6,9-12,18-19H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | MXTGCBDKXZUIFG-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|