C24H32O6-2 — CID 18177546
2,3-bis[(3-pentyloxiran-2-yl)methyl]terephthalate (PubChem CID 18177546) has the molecular formula C24H32O6-2 and a molecular weight of 416.51 g/mol. Its IUPAC name is 2,3-bis[(3-pentyloxiran-2-yl)methyl]terephthalate.
| Compound Name | 2,3-bis[(3-pentyloxiran-2-yl)methyl]terephthalate |
|---|---|
| PubChem CID | 18177546 |
| Molecular Formula | C24H32O6-2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2,3-bis[(3-pentyloxiran-2-yl)methyl]terephthalate |
| SMILES | CCCCCC1OC1Cc1c(C(=O)[O-])ccc(C(=O)[O-])c1CC1OC1CCCCC |
| InChI | InChI=1S/C24H34O6/c1-3-5-7-9-19-21(29-19)13-17-15(23(25)26)11-12-16(24(27)28)18(17)14-22-20(30-22)10-8-6-4-2/h11-12,19-22H,3-10,13-14H2,1-2H3,(H,25,26)(H,27,28)/p-2 |
| InChIKey | DRNLVDGEVLHEQN-UHFFFAOYSA-L |
| XLogP | 2.19 |
| TPSA | 105.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|