C28H46O6-2 — CID 22597284
(Z)-2,3-bis[3-(3-heptyloxiran-2-yl)propyl]but-2-enedioate (PubChem CID 22597284) has the molecular formula C28H46O6-2 and a molecular weight of 478.67 g/mol. Its IUPAC name is (Z)-2,3-bis[3-(3-heptyloxiran-2-yl)propyl]but-2-enedioate.
| Compound Name | (Z)-2,3-bis[3-(3-heptyloxiran-2-yl)propyl]but-2-enedioate |
|---|---|
| PubChem CID | 22597284 |
| Molecular Formula | C28H46O6-2 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (Z)-2,3-bis[3-(3-heptyloxiran-2-yl)propyl]but-2-enedioate |
| SMILES | CCCCCCCC1OC1CCC/C(C(=O)[O-])=C(\CCCC1OC1CCCCCCC)C(=O)[O-] |
| InChI | InChI=1S/C28H48O6/c1-3-5-7-9-11-17-23-25(33-23)19-13-15-21(27(29)30)22(28(31)32)16-14-20-26-24(34-26)18-12-10-8-6-4-2/h23-26H,3-20H2,1-2H3,(H,29,30)(H,31,32)/p-2/b22-21- |
| InChIKey | BPJAIZKCDIIHAI-DQRAZIAOSA-L |
| XLogP | 4.38 |
| TPSA | 105.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|