C10H14N2O4 — CID 142470044
N-(4-ethoxy-4-nitrocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 142470044) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N-(4-ethoxy-4-nitrocyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-(4-ethoxy-4-nitrocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 142470044 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N-(4-ethoxy-4-nitrocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CCOC1([N+](=O)[O-])C=CC(NC(C)=O)=CC1 |
| InChI | InChI=1S/C10H14N2O4/c1-3-16-10(12(14)15)6-4-9(5-7-10)11-8(2)13/h4-6H,3,7H2,1-2H3,(H,11,13) |
| InChIKey | ORKSNKJCMDROHG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|