C13H19NO5 — CID 175200665
ethyl 4-acetamido-6-ethoxy-6-hydroxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 175200665) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is ethyl 4-acetamido-6-ethoxy-6-hydroxycyclohexa-2,4-diene-1-carboxylate.
| Compound Name | ethyl 4-acetamido-6-ethoxy-6-hydroxycyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 175200665 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | ethyl 4-acetamido-6-ethoxy-6-hydroxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1C=CC(NC(C)=O)=CC1(O)OCC |
| InChI | InChI=1S/C13H19NO5/c1-4-18-12(16)11-7-6-10(14-9(3)15)8-13(11,17)19-5-2/h6-8,11,17H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | JGALXUMBVMFOAY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|