C8H9NO5 — CID 163184751
6-hydroxy-3-methoxy-3-nitrocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 163184751) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 6-hydroxy-3-methoxy-3-nitrocyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 6-hydroxy-3-methoxy-3-nitrocyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163184751 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 6-hydroxy-3-methoxy-3-nitrocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | COC1([N+](=O)[O-])C=C(C=O)C(O)=CC1 |
| InChI | InChI=1S/C8H9NO5/c1-14-8(9(12)13)3-2-7(11)6(4-8)5-10/h2,4-5,11H,3H2,1H3 |
| InChIKey | XKBSZJQRAQBCSM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|