C8H8N4O8 — CID 88745401
methyl 6-amino-3,3,5-trinitrocyclohexa-1,5-diene-1-carboxylate (PubChem CID 88745401) has the molecular formula C8H8N4O8 and a molecular weight of 288.17 g/mol. Its IUPAC name is methyl 6-amino-3,3,5-trinitrocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 6-amino-3,3,5-trinitrocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 88745401 |
| Molecular Formula | C8H8N4O8 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | methyl 6-amino-3,3,5-trinitrocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC([N+](=O)[O-])([N+](=O)[O-])CC([N+](=O)[O-])=C1N |
| InChI | InChI=1S/C8H8N4O8/c1-20-7(13)4-2-8(11(16)17,12(18)19)3-5(6(4)9)10(14)15/h2H,3,9H2,1H3 |
| InChIKey | KLMUAMZPIFWMHV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 181.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|